C48H49N3O2S — CID 91286567
3-[5-[2,2-bis[1-(4-butylphenyl)-3,4-dihydro-2H-quinolin-6-yl]ethenyl]thiophen-2-yl]-2-isocyanoprop-2-enoic acid (PubChem CID 91286567) has the molecular formula C48H49N3O2S and a molecular weight of 732.01 g/mol. Its IUPAC name is 3-[5-[2,2-bis[1-(4-butylphenyl)-3,4-dihydro-2H-quinolin-6-yl]ethenyl]thiophen-2-yl]-2-isocyanoprop-2-enoic acid.
| Compound Name | 3-[5-[2,2-bis[1-(4-butylphenyl)-3,4-dihydro-2H-quinolin-6-yl]ethenyl]thiophen-2-yl]-2-isocyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 91286567 |
| Molecular Formula | C48H49N3O2S |
| Molecular Weight | 732.01 g/mol |
| Exact Mass | 731.35 |
| IUPAC Name | 3-[5-[2,2-bis[1-(4-butylphenyl)-3,4-dihydro-2H-quinolin-6-yl]ethenyl]thiophen-2-yl]-2-isocyanoprop-2-enoic acid |
| SMILES | [C-]#[N+]C(=Cc1ccc(C=C(c2ccc3c(c2)CCCN3c2ccc(CCCC)cc2)c2ccc3c(c2)CCCN3c2ccc(CCCC)cc2)s1)C(=O)O |
| InChI | InChI=1S/C48H49N3O2S/c1-4-6-10-34-14-20-40(21-15-34)50-28-8-12-38-30-36(18-26-46(38)50)44(32-42-24-25-43(54-42)33-45(49-3)48(52)53)37-19-27-47-39(31-37)13-9-29-51(47)41-22-16-35(17-23-41)11-7-5-2/h14-27,30-33H,4-13,28-29H2,1-2H3,(H,52,53) |
| InChIKey | JIRKHKXHXQIQSE-UHFFFAOYSA-N |
| XLogP | 12.54 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.01 |
| LogP ≤ 5 | 12.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|