C36H46O — CID 91287648
1-ethyl-2-propylbenzene;[(E)-hept-3-en-4-yl]benzene;1-methoxy-4-methylnaphthalene (PubChem CID 91287648) has the molecular formula C36H46O and a molecular weight of 494.76 g/mol. Its IUPAC name is 1-ethyl-2-propylbenzene;[(E)-hept-3-en-4-yl]benzene;1-methoxy-4-methylnaphthalene.
| Compound Name | 1-ethyl-2-propylbenzene;[(E)-hept-3-en-4-yl]benzene;1-methoxy-4-methylnaphthalene |
|---|---|
| PubChem CID | 91287648 |
| Molecular Formula | C36H46O |
| Molecular Weight | 494.76 g/mol |
| Exact Mass | 494.35 |
| IUPAC Name | 1-ethyl-2-propylbenzene;[(E)-hept-3-en-4-yl]benzene;1-methoxy-4-methylnaphthalene |
| SMILES | CC/C=C(\CCC)c1ccccc1.CCCc1ccccc1CC.COc1ccc(C)c2ccccc12 |
| InChI | InChI=1S/C13H18.C12H12O.C11H16/c1-3-8-12(9-4-2)13-10-6-5-7-11-13;1-9-7-8-12(13-2)11-6-4-3-5-10(9)11;1-3-7-11-9-6-5-8-10(11)4-2/h5-8,10-11H,3-4,9H2,1-2H3;3-8H,1-2H3;5-6,8-9H,3-4,7H2,1-2H3/b12-8+;; |
| InChIKey | FDIDODCLQJVMGW-BPWZRWDXSA-N |
| XLogP | 10.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.76 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |