C11H21N5O2 — CID 91287661
tert-butyl 3-[N'-(methyldiazenyl)carbamimidoyl]pyrrolidine-1-carboxylate (PubChem CID 91287661) has the molecular formula C11H21N5O2 and a molecular weight of 255.32 g/mol. Its IUPAC name is tert-butyl 3-[N'-(methyldiazenyl)carbamimidoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[N'-(methyldiazenyl)carbamimidoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 91287661 |
| Molecular Formula | C11H21N5O2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | tert-butyl 3-[N'-(methyldiazenyl)carbamimidoyl]pyrrolidine-1-carboxylate |
| SMILES | C/N=N/N=C(N)C1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C11H21N5O2/c1-11(2,3)18-10(17)16-6-5-8(7-16)9(12)14-15-13-4/h8H,5-7H2,1-4H3,(H2,12,13,14) |
| InChIKey | DJLJVQKGDMCAFQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 92.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|