C27H30N6O3 — CID 91295699
pentyl 3-[1-(4-carbamoyl-2-methylphenyl)-5-[4-(2H-tetrazol-5-yl)phenyl]pyrrol-2-yl]propanoate (PubChem CID 91295699) has the molecular formula C27H30N6O3 and a molecular weight of 486.58 g/mol. Its IUPAC name is pentyl 3-[1-(4-carbamoyl-2-methylphenyl)-5-[4-(2H-tetrazol-5-yl)phenyl]pyrrol-2-yl]propanoate.
| Compound Name | pentyl 3-[1-(4-carbamoyl-2-methylphenyl)-5-[4-(2H-tetrazol-5-yl)phenyl]pyrrol-2-yl]propanoate |
|---|---|
| PubChem CID | 91295699 |
| Molecular Formula | C27H30N6O3 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | pentyl 3-[1-(4-carbamoyl-2-methylphenyl)-5-[4-(2H-tetrazol-5-yl)phenyl]pyrrol-2-yl]propanoate |
| SMILES | CCCCCOC(=O)CCc1ccc(-c2ccc(-c3nn[nH]n3)cc2)n1-c1ccc(C(N)=O)cc1C |
| InChI | InChI=1S/C27H30N6O3/c1-3-4-5-16-36-25(34)15-12-22-11-14-24(19-6-8-20(9-7-19)27-29-31-32-30-27)33(22)23-13-10-21(26(28)35)17-18(23)2/h6-11,13-14,17H,3-5,12,15-16H2,1-2H3,(H2,28,35)(H,29,30,31,32) |
| InChIKey | IPUAMAOJBVXZAR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 128.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|