C26H29N3O5 — CID 58305741
ethyl 3-[1-(4-carbamoyl-2-methylphenyl)-5-[4-[(2-methoxyacetyl)amino]phenyl]pyrrol-2-yl]propanoate (PubChem CID 58305741) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is ethyl 3-[1-(4-carbamoyl-2-methylphenyl)-5-[4-[(2-methoxyacetyl)amino]phenyl]pyrrol-2-yl]propanoate.
| Compound Name | ethyl 3-[1-(4-carbamoyl-2-methylphenyl)-5-[4-[(2-methoxyacetyl)amino]phenyl]pyrrol-2-yl]propanoate |
|---|---|
| PubChem CID | 58305741 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | ethyl 3-[1-(4-carbamoyl-2-methylphenyl)-5-[4-[(2-methoxyacetyl)amino]phenyl]pyrrol-2-yl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(-c2ccc(NC(=O)COC)cc2)n1-c1ccc(C(N)=O)cc1C |
| InChI | InChI=1S/C26H29N3O5/c1-4-34-25(31)14-11-21-10-13-23(18-5-8-20(9-6-18)28-24(30)16-33-3)29(21)22-12-7-19(26(27)32)15-17(22)2/h5-10,12-13,15H,4,11,14,16H2,1-3H3,(H2,27,32)(H,28,30) |
| InChIKey | FHXIYAFIOJYBJH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|