C26H27N3O3 — CID 67178681
ethyl 3-[1-[4-(1H-imidazol-2-yl)-2-methylphenyl]-5-(4-methoxyphenyl)pyrrol-2-yl]propanoate (PubChem CID 67178681) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is ethyl 3-[1-[4-(1H-imidazol-2-yl)-2-methylphenyl]-5-(4-methoxyphenyl)pyrrol-2-yl]propanoate.
| Compound Name | ethyl 3-[1-[4-(1H-imidazol-2-yl)-2-methylphenyl]-5-(4-methoxyphenyl)pyrrol-2-yl]propanoate |
|---|---|
| PubChem CID | 67178681 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | ethyl 3-[1-[4-(1H-imidazol-2-yl)-2-methylphenyl]-5-(4-methoxyphenyl)pyrrol-2-yl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(-c2ccc(OC)cc2)n1-c1ccc(-c2ncc[nH]2)cc1C |
| InChI | InChI=1S/C26H27N3O3/c1-4-32-25(30)14-9-21-8-13-24(19-5-10-22(31-3)11-6-19)29(21)23-12-7-20(17-18(23)2)26-27-15-16-28-26/h5-8,10-13,15-17H,4,9,14H2,1-3H3,(H,27,28) |
| InChIKey | SNDKNVSIKUKUBI-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|