C17H18N4O2S — CID 91296232
2-[(3-amino-2-thionitrosophenyl)methyl]-N-hydroxy-3,4-dihydro-1H-isoquinoline-6-carboxamide (PubChem CID 91296232) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-[(3-amino-2-thionitrosophenyl)methyl]-N-hydroxy-3,4-dihydro-1H-isoquinoline-6-carboxamide.
| Compound Name | 2-[(3-amino-2-thionitrosophenyl)methyl]-N-hydroxy-3,4-dihydro-1H-isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 91296232 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-[(3-amino-2-thionitrosophenyl)methyl]-N-hydroxy-3,4-dihydro-1H-isoquinoline-6-carboxamide |
| SMILES | Nc1cccc(CN2CCc3cc(C(=O)NO)ccc3C2)c1N=S |
| InChI | InChI=1S/C17H18N4O2S/c18-15-3-1-2-14(16(15)20-24)10-21-7-6-11-8-12(17(22)19-23)4-5-13(11)9-21/h1-5,8,23H,6-7,9-10,18H2,(H,19,22) |
| InChIKey | GWJQWXRJGFOHKS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|