About 8-O-(2-methoxy-2-oxoethyl) 1-O-methyl octanedioate;2-methylbutyl benzoate
8-O-(2-methoxy-2-oxoethyl) 1-O-methyl octanedioate;2-methylbutyl benzoate (PubChem CID 91299758) has the molecular formula C24H36O8
and a molecular weight of 452.54 g/mol. Its IUPAC name is 8-O-(2-methoxy-2-oxoethyl) 1-O-methyl octanedioate;2-methylbutyl benzoate.
Molecular Properties
| Compound Name | 8-O-(2-methoxy-2-oxoethyl) 1-O-methyl octanedioate;2-methylbutyl benzoate |
| PubChem CID | 91299758 |
| Molecular Formula | C24H36O8 |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 8-O-(2-methoxy-2-oxoethyl) 1-O-methyl octanedioate;2-methylbutyl benzoate |
| SMILES | CCC(C)COC(=O)c1ccccc1.COC(=O)CCCCCCC(=O)OCC(=O)OC |
| InChI | InChI=1S/C12H20O6.C12H16O2/c1-16-10(13)7-5-3-4-6-8-11(14)18-9-12(15)17-2;1-3-10(2)9-14-12(13)11-7-5-4-6-8-11/h3-9H2,1-2H3;4-8,10H,3,9H2,1-2H3 |
| InChIKey | XVQJXBJIZLYTHU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-O-(2-methoxy-2-oxoethyl) 1-O-methyl octanedioate;2-methylbutyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-O-(2-methoxy-2-oxoethyl) 1-O-methyl octanedioate;2-methylbutyl benzoate?
The IUPAC name of 8-O-(2-methoxy-2-oxoethyl) 1-O-methyl octanedioate;2-methylbutyl benzoate (CID 91299758) is 8-O-(2-methoxy-2-oxoethyl) 1-O-methyl octanedioate;2-methylbutyl benzoate.
What is the SMILES notation for 8-O-(2-methoxy-2-oxoethyl) 1-O-methyl octanedioate;2-methylbutyl benzoate?
The canonical SMILES for 8-O-(2-methoxy-2-oxoethyl) 1-O-methyl octanedioate;2-methylbutyl benzoate is CCC(C)COC(=O)c1ccccc1.COC(=O)CCCCCCC(=O)OCC(=O)OC.
What is the InChIKey of 8-O-(2-methoxy-2-oxoethyl) 1-O-methyl octanedioate;2-methylbutyl benzoate?
The InChIKey is XVQJXBJIZLYTHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O6.C12H16O2/c1-16-10(13)7-5-3-4-6-8-11(14)18-9-12(15)17-2;1-3-10(2)9-14-12(13)11-7-5-4-6-8-11/h3-9H2,1-2H3;4-8,10H,3,9H2,1-2H3.
What are the key properties of 8-O-(2-methoxy-2-oxoethyl) 1-O-methyl octanedioate;2-methylbutyl benzoate?
8-O-(2-methoxy-2-oxoethyl) 1-O-methyl octanedioate;2-methylbutyl benzoate has a molecular weight of 452.54 g/mol, XLogP of 4.11, 13 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 8-O-(2-methoxy-2-oxoethyl) 1-O-methyl octanedioate;2-methylbutyl benzoate is sourced from PubChem (CID 91299758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).