C18H29N3O3 — CID 91301353
N-(2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl)-3-methylbutanamide (PubChem CID 91301353) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is N-(2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl)-3-methylbutanamide.
| Compound Name | N-(2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 91301353 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | N-(2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl)-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NC1C=CCCNC(=O)C=CC(C(C)C)NC1=O |
| InChI | InChI=1S/C18H29N3O3/c1-12(2)11-17(23)20-15-7-5-6-10-19-16(22)9-8-14(13(3)4)21-18(15)24/h5,7-9,12-15H,6,10-11H2,1-4H3,(H,19,22)(H,20,23)(H,21,24) |
| InChIKey | YQURHUBXSBDCJR-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|