C18H19Cl2NO2 — CID 91302047
1-benzyl-4-(4,5-dichlorocyclohexa-1,5-dien-1-yl)pyrrolidine-3-carboxylic acid (PubChem CID 91302047) has the molecular formula C18H19Cl2NO2 and a molecular weight of 352.26 g/mol. Its IUPAC name is 1-benzyl-4-(4,5-dichlorocyclohexa-1,5-dien-1-yl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-benzyl-4-(4,5-dichlorocyclohexa-1,5-dien-1-yl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 91302047 |
| Molecular Formula | C18H19Cl2NO2 |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 1-benzyl-4-(4,5-dichlorocyclohexa-1,5-dien-1-yl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CN(Cc2ccccc2)CC1C1=CCC(Cl)C(Cl)=C1 |
| InChI | InChI=1S/C18H19Cl2NO2/c19-16-7-6-13(8-17(16)20)14-10-21(11-15(14)18(22)23)9-12-4-2-1-3-5-12/h1-6,8,14-16H,7,9-11H2,(H,22,23) |
| InChIKey | GSVKXDRZDOHWHW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|