C20H17Cl2NO2 — CID 91306636
6-(N-benzyl-3-hydroxyanilino)-2,4-dichloro-3-methylphenol (PubChem CID 91306636) has the molecular formula C20H17Cl2NO2 and a molecular weight of 374.27 g/mol. Its IUPAC name is 6-(N-benzyl-3-hydroxyanilino)-2,4-dichloro-3-methylphenol.
| Compound Name | 6-(N-benzyl-3-hydroxyanilino)-2,4-dichloro-3-methylphenol |
|---|---|
| PubChem CID | 91306636 |
| Molecular Formula | C20H17Cl2NO2 |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 6-(N-benzyl-3-hydroxyanilino)-2,4-dichloro-3-methylphenol |
| SMILES | Cc1c(Cl)cc(N(Cc2ccccc2)c2cccc(O)c2)c(O)c1Cl |
| InChI | InChI=1S/C20H17Cl2NO2/c1-13-17(21)11-18(20(25)19(13)22)23(12-14-6-3-2-4-7-14)15-8-5-9-16(24)10-15/h2-11,24-25H,12H2,1H3 |
| InChIKey | LPAMWCDJYBCWOX-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |