C21H20Cl2N2 — CID 174756588
1-N,3-N-dibenzyl-1-N,3-N-dichloro-2-methylbenzene-1,3-diamine (PubChem CID 174756588) has the molecular formula C21H20Cl2N2 and a molecular weight of 371.31 g/mol. Its IUPAC name is 1-N,3-N-dibenzyl-1-N,3-N-dichloro-2-methylbenzene-1,3-diamine.
| Compound Name | 1-N,3-N-dibenzyl-1-N,3-N-dichloro-2-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 174756588 |
| Molecular Formula | C21H20Cl2N2 |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 1-N,3-N-dibenzyl-1-N,3-N-dichloro-2-methylbenzene-1,3-diamine |
| SMILES | Cc1c(N(Cl)Cc2ccccc2)cccc1N(Cl)Cc1ccccc1 |
| InChI | InChI=1S/C21H20Cl2N2/c1-17-20(24(22)15-18-9-4-2-5-10-18)13-8-14-21(17)25(23)16-19-11-6-3-7-12-19/h2-14H,15-16H2,1H3 |
| InChIKey | XCMIZOYWGVMFDQ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|