C14H23N7O3 — CID 91307126
[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-1,3,5-triazin-2-yl]methyldiazene (PubChem CID 91307126) has the molecular formula C14H23N7O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is [4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-1,3,5-triazin-2-yl]methyldiazene.
| Compound Name | [4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-1,3,5-triazin-2-yl]methyldiazene |
|---|---|
| PubChem CID | 91307126 |
| Molecular Formula | C14H23N7O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | [4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-1,3,5-triazin-2-yl]methyldiazene |
| SMILES | [H]/N=N/Cc1nc(OCCN2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C14H23N7O3/c15-16-11-12-17-13(21-4-8-23-9-5-21)19-14(18-12)24-10-3-20-1-6-22-7-2-20/h15H,1-11H2/b16-15+ |
| InChIKey | AHQGKNVKMJZULO-FOCLMDBBSA-N |
| XLogP | -0.05 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|