C20H20N4O3 — CID 91309166
4-[[3-(3,5-dicyano-2,6-dimethyl-3,4-dihydropyridin-4-yl)benzoyl]amino]butanoic acid (PubChem CID 91309166) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 4-[[3-(3,5-dicyano-2,6-dimethyl-3,4-dihydropyridin-4-yl)benzoyl]amino]butanoic acid.
| Compound Name | 4-[[3-(3,5-dicyano-2,6-dimethyl-3,4-dihydropyridin-4-yl)benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 91309166 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 4-[[3-(3,5-dicyano-2,6-dimethyl-3,4-dihydropyridin-4-yl)benzoyl]amino]butanoic acid |
| SMILES | CC1=NC(C)=C(C#N)C(c2cccc(C(=O)NCCCC(=O)O)c2)C1C#N |
| InChI | InChI=1S/C20H20N4O3/c1-12-16(10-21)19(17(11-22)13(2)24-12)14-5-3-6-15(9-14)20(27)23-8-4-7-18(25)26/h3,5-6,9,16,19H,4,7-8H2,1-2H3,(H,23,27)(H,25,26) |
| InChIKey | WBTLLLJKQQWJRB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 126.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|