C22H22N6O — CID 91613492
3-(3,5-dicyano-2,6-dimethyl-3,4-dihydropyridin-4-yl)-N-(3-imidazol-1-ylpropyl)benzamide (PubChem CID 91613492) has the molecular formula C22H22N6O and a molecular weight of 386.46 g/mol. Its IUPAC name is 3-(3,5-dicyano-2,6-dimethyl-3,4-dihydropyridin-4-yl)-N-(3-imidazol-1-ylpropyl)benzamide.
| Compound Name | 3-(3,5-dicyano-2,6-dimethyl-3,4-dihydropyridin-4-yl)-N-(3-imidazol-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 91613492 |
| Molecular Formula | C22H22N6O |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 3-(3,5-dicyano-2,6-dimethyl-3,4-dihydropyridin-4-yl)-N-(3-imidazol-1-ylpropyl)benzamide |
| SMILES | CC1=NC(C)=C(C#N)C(c2cccc(C(=O)NCCCn3ccnc3)c2)C1C#N |
| InChI | InChI=1S/C22H22N6O/c1-15-19(12-23)21(20(13-24)16(2)27-15)17-5-3-6-18(11-17)22(29)26-7-4-9-28-10-8-25-14-28/h3,5-6,8,10-11,14,19,21H,4,7,9H2,1-2H3,(H,26,29) |
| InChIKey | IQWZLBJBZCAPAF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|