C27H34N2O5 — CID 91312842
ethyl 2-[4-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]anilino]-3-oxoprop-1-enyl]phenyl]pentanoate (PubChem CID 91312842) has the molecular formula C27H34N2O5 and a molecular weight of 466.58 g/mol. Its IUPAC name is ethyl 2-[4-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]anilino]-3-oxoprop-1-enyl]phenyl]pentanoate.
| Compound Name | ethyl 2-[4-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]anilino]-3-oxoprop-1-enyl]phenyl]pentanoate |
|---|---|
| PubChem CID | 91312842 |
| Molecular Formula | C27H34N2O5 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | ethyl 2-[4-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]anilino]-3-oxoprop-1-enyl]phenyl]pentanoate |
| SMILES | CCCC(C(=O)OCC)c1ccc(C=CC(=O)Nc2ccccc2NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C27H34N2O5/c1-6-10-21(25(31)33-7-2)20-16-13-19(14-17-20)15-18-24(30)28-22-11-8-9-12-23(22)29-26(32)34-27(3,4)5/h8-9,11-18,21H,6-7,10H2,1-5H3,(H,28,30)(H,29,32) |
| InChIKey | SBLJMCDVOAHENB-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|