C36H47N3O5Si — CID 59238264
tert-butyl N-[2-[[(E)-3-[4-[1-anilino-4-[tert-butyl(dimethyl)silyl]oxy-1-oxobutan-2-yl]phenyl]prop-2-enoyl]amino]phenyl]carbamate (PubChem CID 59238264) has the molecular formula C36H47N3O5Si and a molecular weight of 629.87 g/mol. Its IUPAC name is tert-butyl N-[2-[[(E)-3-[4-[1-anilino-4-[tert-butyl(dimethyl)silyl]oxy-1-oxobutan-2-yl]phenyl]prop-2-enoyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(E)-3-[4-[1-anilino-4-[tert-butyl(dimethyl)silyl]oxy-1-oxobutan-2-yl]phenyl]prop-2-enoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 59238264 |
| Molecular Formula | C36H47N3O5Si |
| Molecular Weight | 629.87 g/mol |
| Exact Mass | 629.33 |
| IUPAC Name | tert-butyl N-[2-[[(E)-3-[4-[1-anilino-4-[tert-butyl(dimethyl)silyl]oxy-1-oxobutan-2-yl]phenyl]prop-2-enoyl]amino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccccc1NC(=O)/C=C/c1ccc(C(CCO[Si](C)(C)C(C)(C)C)C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C36H47N3O5Si/c1-35(2,3)44-34(42)39-31-17-13-12-16-30(31)38-32(40)23-20-26-18-21-27(22-19-26)29(24-25-43-45(7,8)36(4,5)6)33(41)37-28-14-10-9-11-15-28/h9-23,29H,24-25H2,1-8H3,(H,37,41)(H,38,40)(H,39,42)/b23-20+ |
| InChIKey | VBYAVFLTSOLJDB-BSYVCWPDSA-N |
| XLogP | 8.82 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.87 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|