C21H21Cl2N3O3 — CID 91313478
2-[2-[[4-(2,6-dichlorophenyl)buta-1,3-dien-2-ylamino]oxymethyl]phenyl]-3-(methoxyamino)prop-2-enamide (PubChem CID 91313478) has the molecular formula C21H21Cl2N3O3 and a molecular weight of 434.32 g/mol. Its IUPAC name is 2-[2-[[4-(2,6-dichlorophenyl)buta-1,3-dien-2-ylamino]oxymethyl]phenyl]-3-(methoxyamino)prop-2-enamide.
| Compound Name | 2-[2-[[4-(2,6-dichlorophenyl)buta-1,3-dien-2-ylamino]oxymethyl]phenyl]-3-(methoxyamino)prop-2-enamide |
|---|---|
| PubChem CID | 91313478 |
| Molecular Formula | C21H21Cl2N3O3 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 2-[2-[[4-(2,6-dichlorophenyl)buta-1,3-dien-2-ylamino]oxymethyl]phenyl]-3-(methoxyamino)prop-2-enamide |
| SMILES | C=C(C=Cc1c(Cl)cccc1Cl)NOCc1ccccc1C(=CNOC)C(N)=O |
| InChI | InChI=1S/C21H21Cl2N3O3/c1-14(10-11-17-19(22)8-5-9-20(17)23)26-29-13-15-6-3-4-7-16(15)18(21(24)27)12-25-28-2/h3-12,25-26H,1,13H2,2H3,(H2,24,27) |
| InChIKey | AQHCLQPSKZWDKR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|