C25H52O10 — CID 91313722
1-(6-dodecan-4-yloxy-1,4,6-trihydroxy-5-methylhexan-3-yl)oxyhexane-1,2,3,4,6-pentol (PubChem CID 91313722) has the molecular formula C25H52O10 and a molecular weight of 512.68 g/mol. Its IUPAC name is 1-(6-dodecan-4-yloxy-1,4,6-trihydroxy-5-methylhexan-3-yl)oxyhexane-1,2,3,4,6-pentol.
| Compound Name | 1-(6-dodecan-4-yloxy-1,4,6-trihydroxy-5-methylhexan-3-yl)oxyhexane-1,2,3,4,6-pentol |
|---|---|
| PubChem CID | 91313722 |
| Molecular Formula | C25H52O10 |
| Molecular Weight | 512.68 g/mol |
| Exact Mass | 512.36 |
| IUPAC Name | 1-(6-dodecan-4-yloxy-1,4,6-trihydroxy-5-methylhexan-3-yl)oxyhexane-1,2,3,4,6-pentol |
| SMILES | CCCCCCCCC(CCC)OC(O)C(C)C(O)C(CCO)OC(O)C(O)C(O)C(O)CCO |
| InChI | InChI=1S/C25H52O10/c1-4-6-7-8-9-10-12-18(11-5-2)34-24(32)17(3)21(29)20(14-16-27)35-25(33)23(31)22(30)19(28)13-15-26/h17-33H,4-16H2,1-3H3 |
| InChIKey | SPTUIZRHGCEZOA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 180.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.68 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|