C16H34O6 — CID 91342707
1-decan-2-yloxyhexane-1,2,3,4,6-pentol (PubChem CID 91342707) has the molecular formula C16H34O6 and a molecular weight of 322.44 g/mol. Its IUPAC name is 1-decan-2-yloxyhexane-1,2,3,4,6-pentol.
| Compound Name | 1-decan-2-yloxyhexane-1,2,3,4,6-pentol |
|---|---|
| PubChem CID | 91342707 |
| Molecular Formula | C16H34O6 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 1-decan-2-yloxyhexane-1,2,3,4,6-pentol |
| SMILES | CCCCCCCCC(C)OC(O)C(O)C(O)C(O)CCO |
| InChI | InChI=1S/C16H34O6/c1-3-4-5-6-7-8-9-12(2)22-16(21)15(20)14(19)13(18)10-11-17/h12-21H,3-11H2,1-2H3 |
| InChIKey | MODHZFNSIVWFRX-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|