C25H31NO6S2 — CID 91318073
9-(acetyloxymethyl)-7-(2-tert-butylsulfanylpentanoylamino)-9H-fluorene-2-sulfonic acid (PubChem CID 91318073) has the molecular formula C25H31NO6S2 and a molecular weight of 505.66 g/mol. Its IUPAC name is 9-(acetyloxymethyl)-7-(2-tert-butylsulfanylpentanoylamino)-9H-fluorene-2-sulfonic acid.
| Compound Name | 9-(acetyloxymethyl)-7-(2-tert-butylsulfanylpentanoylamino)-9H-fluorene-2-sulfonic acid |
|---|---|
| PubChem CID | 91318073 |
| Molecular Formula | C25H31NO6S2 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | 9-(acetyloxymethyl)-7-(2-tert-butylsulfanylpentanoylamino)-9H-fluorene-2-sulfonic acid |
| SMILES | CCCC(SC(C)(C)C)C(=O)Nc1ccc2c(c1)C(COC(C)=O)c1cc(S(=O)(=O)O)ccc1-2 |
| InChI | InChI=1S/C25H31NO6S2/c1-6-7-23(33-25(3,4)5)24(28)26-16-8-10-18-19-11-9-17(34(29,30)31)13-21(19)22(20(18)12-16)14-32-15(2)27/h8-13,22-23H,6-7,14H2,1-5H3,(H,26,28)(H,29,30,31) |
| InChIKey | XVZZEKKFOGRPCT-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|