C16H24O5 — CID 91318791
5-dec-4-enoyl-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 91318791) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is 5-dec-4-enoyl-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-dec-4-enoyl-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 91318791 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 5-dec-4-enoyl-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CCCCCC=CCCC(=O)C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C16H24O5/c1-4-5-6-7-8-9-10-11-12(17)13-14(18)20-16(2,3)21-15(13)19/h8-9,13H,4-7,10-11H2,1-3H3 |
| InChIKey | DFMHWPDNQBCVHE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|