C17H24O4 — CID 143812879
2,2-dimethyl-5-[(4-methylcyclohepta-1,3,6-trien-1-yl)methyl]-1,3-dioxane-4,6-dione;ethane (PubChem CID 143812879) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is 2,2-dimethyl-5-[(4-methylcyclohepta-1,3,6-trien-1-yl)methyl]-1,3-dioxane-4,6-dione;ethane.
| Compound Name | 2,2-dimethyl-5-[(4-methylcyclohepta-1,3,6-trien-1-yl)methyl]-1,3-dioxane-4,6-dione;ethane |
|---|---|
| PubChem CID | 143812879 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 2,2-dimethyl-5-[(4-methylcyclohepta-1,3,6-trien-1-yl)methyl]-1,3-dioxane-4,6-dione;ethane |
| SMILES | CC.CC1=CC=C(CC2C(=O)OC(C)(C)OC2=O)C=CC1 |
| InChI | InChI=1S/C15H18O4.C2H6/c1-10-5-4-6-11(8-7-10)9-12-13(16)18-15(2,3)19-14(12)17;1-2/h4,6-8,12H,5,9H2,1-3H3;1-2H3 |
| InChIKey | NRMUAWBWYWALEP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|