C17H26O5 — CID 10870621
methyl (5Z,7E)-8-[(4R,5S)-2,2-dimethyl-4-(2-oxoethyl)-1,3-dioxan-5-yl]octa-5,7-dienoate (PubChem CID 10870621) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is methyl (5Z,7E)-8-[(4R,5S)-2,2-dimethyl-4-(2-oxoethyl)-1,3-dioxan-5-yl]octa-5,7-dienoate.
| Compound Name | methyl (5Z,7E)-8-[(4R,5S)-2,2-dimethyl-4-(2-oxoethyl)-1,3-dioxan-5-yl]octa-5,7-dienoate |
|---|---|
| PubChem CID | 10870621 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | methyl (5Z,7E)-8-[(4R,5S)-2,2-dimethyl-4-(2-oxoethyl)-1,3-dioxan-5-yl]octa-5,7-dienoate |
| SMILES | COC(=O)CCC/C=C\C=C\[C@H]1COC(C)(C)O[C@@H]1CC=O |
| InChI | InChI=1S/C17H26O5/c1-17(2)21-13-14(15(22-17)11-12-18)9-7-5-4-6-8-10-16(19)20-3/h4-5,7,9,12,14-15H,6,8,10-11,13H2,1-3H3/b5-4-,9-7+/t14-,15+/m0/s1 |
| InChIKey | MEKYLTNTAQHJCF-NHKVTVCZSA-N |
| XLogP | 2.80 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|