C25H34O3 — CID 91318801
(13S,14R)-17-hydroxy-3-methoxy-13-methyl-11-pentyl-7,12,14,15,16,17-hexahydro-6H-cyclopenta[a]phenanthrene-8-carbaldehyde (PubChem CID 91318801) has the molecular formula C25H34O3 and a molecular weight of 382.54 g/mol. Its IUPAC name is (13S,14R)-17-hydroxy-3-methoxy-13-methyl-11-pentyl-7,12,14,15,16,17-hexahydro-6H-cyclopenta[a]phenanthrene-8-carbaldehyde.
| Compound Name | (13S,14R)-17-hydroxy-3-methoxy-13-methyl-11-pentyl-7,12,14,15,16,17-hexahydro-6H-cyclopenta[a]phenanthrene-8-carbaldehyde |
|---|---|
| PubChem CID | 91318801 |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | (13S,14R)-17-hydroxy-3-methoxy-13-methyl-11-pentyl-7,12,14,15,16,17-hexahydro-6H-cyclopenta[a]phenanthrene-8-carbaldehyde |
| SMILES | CCCCCC1=C2c3ccc(OC)cc3CCC2(C=O)[C@@H]2CCC(O)[C@@]2(C)C1 |
| InChI | InChI=1S/C25H34O3/c1-4-5-6-7-18-15-24(2)21(10-11-22(24)27)25(16-26)13-12-17-14-19(28-3)8-9-20(17)23(18)25/h8-9,14,16,21-22,27H,4-7,10-13,15H2,1-3H3/t21-,22?,24+,25?/m1/s1 |
| InChIKey | NFJOKPOSGBOYLS-CNKBSYILSA-N |
| XLogP | 5.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|