C21H25IO2 — CID 142090136
(8-ethenyl-3-methoxy-13-methyl-7,12,14,15,16,17-hexahydro-6H-cyclopenta[a]phenanthren-17-yl) hypoiodite (PubChem CID 142090136) has the molecular formula C21H25IO2 and a molecular weight of 436.33 g/mol. Its IUPAC name is (8-ethenyl-3-methoxy-13-methyl-7,12,14,15,16,17-hexahydro-6H-cyclopenta[a]phenanthren-17-yl) hypoiodite.
| Compound Name | (8-ethenyl-3-methoxy-13-methyl-7,12,14,15,16,17-hexahydro-6H-cyclopenta[a]phenanthren-17-yl) hypoiodite |
|---|---|
| PubChem CID | 142090136 |
| Molecular Formula | C21H25IO2 |
| Molecular Weight | 436.33 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | (8-ethenyl-3-methoxy-13-methyl-7,12,14,15,16,17-hexahydro-6H-cyclopenta[a]phenanthren-17-yl) hypoiodite |
| SMILES | C=CC12CCc3cc(OC)ccc3C1=CCC1(C)C(OI)CCC21 |
| InChI | InChI=1S/C21H25IO2/c1-4-21-12-9-14-13-15(23-3)5-6-16(14)17(21)10-11-20(2)18(21)7-8-19(20)24-22/h4-6,10,13,18-19H,1,7-9,11-12H2,2-3H3 |
| InChIKey | MWEJBMVCOXSPNT-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.33 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|