C25H39N5O2 — CID 91322048
N-cyclohexyl-3-[[4-(4-methylpiperazine-1-carbonyl)piperidin-1-yl]methyl]benzohydrazide (PubChem CID 91322048) has the molecular formula C25H39N5O2 and a molecular weight of 441.62 g/mol. Its IUPAC name is N-cyclohexyl-3-[[4-(4-methylpiperazine-1-carbonyl)piperidin-1-yl]methyl]benzohydrazide.
| Compound Name | N-cyclohexyl-3-[[4-(4-methylpiperazine-1-carbonyl)piperidin-1-yl]methyl]benzohydrazide |
|---|---|
| PubChem CID | 91322048 |
| Molecular Formula | C25H39N5O2 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.31 |
| IUPAC Name | N-cyclohexyl-3-[[4-(4-methylpiperazine-1-carbonyl)piperidin-1-yl]methyl]benzohydrazide |
| SMILES | CN1CCN(C(=O)C2CCN(Cc3cccc(C(=O)N(N)C4CCCCC4)c3)CC2)CC1 |
| InChI | InChI=1S/C25H39N5O2/c1-27-14-16-29(17-15-27)24(31)21-10-12-28(13-11-21)19-20-6-5-7-22(18-20)25(32)30(26)23-8-3-2-4-9-23/h5-7,18,21,23H,2-4,8-17,19,26H2,1H3 |
| InChIKey | IGJWFDJHBRMSRK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|