C27H41FN6O3 — CID 91324265
2-amino-2-[N-[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-4-[(4-ethylpiperazin-1-yl)methyl]-3-fluoroanilino]-N-ethylacetamide (PubChem CID 91324265) has the molecular formula C27H41FN6O3 and a molecular weight of 516.66 g/mol. Its IUPAC name is 2-amino-2-[N-[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-4-[(4-ethylpiperazin-1-yl)methyl]-3-fluoroanilino]-N-ethylacetamide.
| Compound Name | 2-amino-2-[N-[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-4-[(4-ethylpiperazin-1-yl)methyl]-3-fluoroanilino]-N-ethylacetamide |
|---|---|
| PubChem CID | 91324265 |
| Molecular Formula | C27H41FN6O3 |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.32 |
| IUPAC Name | 2-amino-2-[N-[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-4-[(4-ethylpiperazin-1-yl)methyl]-3-fluoroanilino]-N-ethylacetamide |
| SMILES | CCNC(=O)C(N)N(c1ccc(CN2CCN(CC)CC2)c(F)c1)C(N)c1cc(C(C)C)c(O)cc1O |
| InChI | InChI=1S/C27H41FN6O3/c1-5-31-27(37)26(30)34(25(29)21-14-20(17(3)4)23(35)15-24(21)36)19-8-7-18(22(28)13-19)16-33-11-9-32(6-2)10-12-33/h7-8,13-15,17,25-26,35-36H,5-6,9-12,16,29-30H2,1-4H3,(H,31,37) |
| InChIKey | KDWPJQWRDCOYLF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|