About 2-but-1-enyl-3-methyl-3a,7a-dihydro-1-benzothiophene
2-but-1-enyl-3-methyl-3a,7a-dihydro-1-benzothiophene (PubChem CID 91324955) has the molecular formula C13H16S
and a molecular weight of 204.34 g/mol. Its IUPAC name is 2-but-1-enyl-3-methyl-3a,7a-dihydro-1-benzothiophene.
Analyze 2-but-1-enyl-3-methyl-3a,7a-dihydro-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-1-enyl-3-methyl-3a,7a-dihydro-1-benzothiophene?
The IUPAC name of 2-but-1-enyl-3-methyl-3a,7a-dihydro-1-benzothiophene (CID 91324955) is 2-but-1-enyl-3-methyl-3a,7a-dihydro-1-benzothiophene.
What is the SMILES notation for 2-but-1-enyl-3-methyl-3a,7a-dihydro-1-benzothiophene?
The canonical SMILES for 2-but-1-enyl-3-methyl-3a,7a-dihydro-1-benzothiophene is CCC=CC1=C(C)C2C=CC=CC2S1.
What is the InChIKey of 2-but-1-enyl-3-methyl-3a,7a-dihydro-1-benzothiophene?
The InChIKey is XXPPEFMDLMIOTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16S/c1-3-4-8-12-10(2)11-7-5-6-9-13(11)14-12/h4-9,11,13H,3H2,1-2H3.
What are the key properties of 2-but-1-enyl-3-methyl-3a,7a-dihydro-1-benzothiophene?
2-but-1-enyl-3-methyl-3a,7a-dihydro-1-benzothiophene has a molecular weight of 204.34 g/mol, XLogP of 4.08, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-1-enyl-3-methyl-3a,7a-dihydro-1-benzothiophene is sourced from PubChem (CID 91324955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).