C25H38N2O2S — CID 91325967
3-butyl-N,N,3,4-tetramethyl-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6-benzothiepin-7-amine;methanamine (PubChem CID 91325967) has the molecular formula C25H38N2O2S and a molecular weight of 430.66 g/mol. Its IUPAC name is 3-butyl-N,N,3,4-tetramethyl-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6-benzothiepin-7-amine;methanamine.
| Compound Name | 3-butyl-N,N,3,4-tetramethyl-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6-benzothiepin-7-amine;methanamine |
|---|---|
| PubChem CID | 91325967 |
| Molecular Formula | C25H38N2O2S |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 3-butyl-N,N,3,4-tetramethyl-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6-benzothiepin-7-amine;methanamine |
| SMILES | CCCCC1(C)CS(=O)(=O)c2ccc(N(C)C)cc2C(c2ccccc2)C1C.CN |
| InChI | InChI=1S/C24H33NO2S.CH5N/c1-6-7-15-24(3)17-28(26,27)22-14-13-20(25(4)5)16-21(22)23(18(24)2)19-11-9-8-10-12-19;1-2/h8-14,16,18,23H,6-7,15,17H2,1-5H3;2H2,1H3 |
| InChIKey | VXWKFNUPNTWXLK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |