C23H30N2O3S — CID 134186898
(2S,3S,5S)-2-(3-aminophenyl)-5-butyl-11-(dimethylamino)-7,7-dioxo-7λ6-thiatricyclo[6.4.0.03,5]dodeca-1(8),9,11-trien-3-ol (PubChem CID 134186898) has the molecular formula C23H30N2O3S and a molecular weight of 414.57 g/mol. Its IUPAC name is (2S,3S,5S)-2-(3-aminophenyl)-5-butyl-11-(dimethylamino)-7,7-dioxo-7λ6-thiatricyclo[6.4.0.03,5]dodeca-1(8),9,11-trien-3-ol.
| Compound Name | (2S,3S,5S)-2-(3-aminophenyl)-5-butyl-11-(dimethylamino)-7,7-dioxo-7λ6-thiatricyclo[6.4.0.03,5]dodeca-1(8),9,11-trien-3-ol |
|---|---|
| PubChem CID | 134186898 |
| Molecular Formula | C23H30N2O3S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (2S,3S,5S)-2-(3-aminophenyl)-5-butyl-11-(dimethylamino)-7,7-dioxo-7λ6-thiatricyclo[6.4.0.03,5]dodeca-1(8),9,11-trien-3-ol |
| SMILES | CCCC[C@]12C[C@]1(O)[C@@H](c1cccc(N)c1)c1cc(N(C)C)ccc1S(=O)(=O)C2 |
| InChI | InChI=1S/C23H30N2O3S/c1-4-5-11-22-14-23(22,26)21(16-7-6-8-17(24)12-16)19-13-18(25(2)3)9-10-20(19)29(27,28)15-22/h6-10,12-13,21,26H,4-5,11,14-15,24H2,1-3H3/t21-,22+,23-/m0/s1 |
| InChIKey | GCZGEZQBFBFHSE-ZRBLBEILSA-N |
| XLogP | 3.57 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|