C30H38O10 — CID 91328197
2-butyl-2-[(3-methoxycarbonylphenyl)methyl]propanedioic acid;3-(2-carboxyhexyl)benzoic acid (PubChem CID 91328197) has the molecular formula C30H38O10 and a molecular weight of 558.62 g/mol. Its IUPAC name is 2-butyl-2-[(3-methoxycarbonylphenyl)methyl]propanedioic acid;3-(2-carboxyhexyl)benzoic acid.
| Compound Name | 2-butyl-2-[(3-methoxycarbonylphenyl)methyl]propanedioic acid;3-(2-carboxyhexyl)benzoic acid |
|---|---|
| PubChem CID | 91328197 |
| Molecular Formula | C30H38O10 |
| Molecular Weight | 558.62 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | 2-butyl-2-[(3-methoxycarbonylphenyl)methyl]propanedioic acid;3-(2-carboxyhexyl)benzoic acid |
| SMILES | CCCCC(Cc1cccc(C(=O)O)c1)C(=O)O.CCCCC(Cc1cccc(C(=O)OC)c1)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H20O6.C14H18O4/c1-3-4-8-16(14(18)19,15(20)21)10-11-6-5-7-12(9-11)13(17)22-2;1-2-3-6-11(13(15)16)8-10-5-4-7-12(9-10)14(17)18/h5-7,9H,3-4,8,10H2,1-2H3,(H,18,19)(H,20,21);4-5,7,9,11H,2-3,6,8H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | HABGNIGNLLQGBQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 175.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.62 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|