C16H20O6 — CID 20778209
2-butyl-2-[(3-methoxycarbonylphenyl)methyl]propanedioic acid (PubChem CID 20778209) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is 2-butyl-2-[(3-methoxycarbonylphenyl)methyl]propanedioic acid.
| Compound Name | 2-butyl-2-[(3-methoxycarbonylphenyl)methyl]propanedioic acid |
|---|---|
| PubChem CID | 20778209 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-butyl-2-[(3-methoxycarbonylphenyl)methyl]propanedioic acid |
| SMILES | CCCCC(Cc1cccc(C(=O)OC)c1)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H20O6/c1-3-4-8-16(14(18)19,15(20)21)10-11-6-5-7-12(9-11)13(17)22-2/h5-7,9H,3-4,8,10H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | ACFWPSNIEUMTPW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|