C21H22NO9S- — CID 91936133
N-[4-[3-methoxy-2-methoxycarbonyl-2-[(3-methoxycarbonylphenyl)methyl]-3-oxopropyl]phenyl]sulfamate (PubChem CID 91936133) has the molecular formula C21H22NO9S- and a molecular weight of 464.47 g/mol. Its IUPAC name is N-[4-[3-methoxy-2-methoxycarbonyl-2-[(3-methoxycarbonylphenyl)methyl]-3-oxopropyl]phenyl]sulfamate.
| Compound Name | N-[4-[3-methoxy-2-methoxycarbonyl-2-[(3-methoxycarbonylphenyl)methyl]-3-oxopropyl]phenyl]sulfamate |
|---|---|
| PubChem CID | 91936133 |
| Molecular Formula | C21H22NO9S- |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | N-[4-[3-methoxy-2-methoxycarbonyl-2-[(3-methoxycarbonylphenyl)methyl]-3-oxopropyl]phenyl]sulfamate |
| SMILES | COC(=O)c1cccc(CC(Cc2ccc(NS(=O)(=O)[O-])cc2)(C(=O)OC)C(=O)OC)c1 |
| InChI | InChI=1S/C21H23NO9S/c1-29-18(23)16-6-4-5-15(11-16)13-21(19(24)30-2,20(25)31-3)12-14-7-9-17(10-8-14)22-32(26,27)28/h4-11,22H,12-13H2,1-3H3,(H,26,27,28)/p-1 |
| InChIKey | RJZYCVCUOYFXFY-UHFFFAOYSA-M |
| XLogP | 1.46 |
| TPSA | 148.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|