C35H48BrNO12S2 — CID 158389680
3-[2-carboxy-5-[1-(hydroxyamino)-1-oxobutan-2-yl]sulfanylpentyl]benzoic acid;3-(2-carboxy-5-sulfanylpentyl)benzoic acid;methyl 2-bromobutanoate (PubChem CID 158389680) has the molecular formula C35H48BrNO12S2 and a molecular weight of 818.80 g/mol. Its IUPAC name is 3-[2-carboxy-5-[1-(hydroxyamino)-1-oxobutan-2-yl]sulfanylpentyl]benzoic acid;3-(2-carboxy-5-sulfanylpentyl)benzoic acid;methyl 2-bromobutanoate.
| Compound Name | 3-[2-carboxy-5-[1-(hydroxyamino)-1-oxobutan-2-yl]sulfanylpentyl]benzoic acid;3-(2-carboxy-5-sulfanylpentyl)benzoic acid;methyl 2-bromobutanoate |
|---|---|
| PubChem CID | 158389680 |
| Molecular Formula | C35H48BrNO12S2 |
| Molecular Weight | 818.80 g/mol |
| Exact Mass | 817.18 |
| IUPAC Name | 3-[2-carboxy-5-[1-(hydroxyamino)-1-oxobutan-2-yl]sulfanylpentyl]benzoic acid;3-(2-carboxy-5-sulfanylpentyl)benzoic acid;methyl 2-bromobutanoate |
| SMILES | CCC(Br)C(=O)OC.CCC(SCCCC(Cc1cccc(C(=O)O)c1)C(=O)O)C(=O)NO.O=C(O)c1cccc(CC(CCCS)C(=O)O)c1 |
| InChI | InChI=1S/C17H23NO6S.C13H16O4S.C5H9BrO2/c1-2-14(15(19)18-24)25-8-4-7-13(17(22)23)10-11-5-3-6-12(9-11)16(20)21;14-12(15)10-4-1-3-9(7-10)8-11(13(16)17)5-2-6-18;1-3-4(6)5(7)8-2/h3,5-6,9,13-14,24H,2,4,7-8,10H2,1H3,(H,18,19)(H,20,21)(H,22,23);1,3-4,7,11,18H,2,5-6,8H2,(H,14,15)(H,16,17);4H,3H2,1-2H3 |
| InChIKey | GWULBTCQBIFDGF-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 224.83 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.80 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|