About propyl 3-(4-hydroxy-3,5-dimethylcyclohexa-1,5-dien-1-yl)propanoate
propyl 3-(4-hydroxy-3,5-dimethylcyclohexa-1,5-dien-1-yl)propanoate (PubChem CID 91333488) has the molecular formula C14H22O3
and a molecular weight of 238.33 g/mol. Its IUPAC name is propyl 3-(4-hydroxy-3,5-dimethylcyclohexa-1,5-dien-1-yl)propanoate.
Molecular Properties
| Compound Name | propyl 3-(4-hydroxy-3,5-dimethylcyclohexa-1,5-dien-1-yl)propanoate |
| PubChem CID | 91333488 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | propyl 3-(4-hydroxy-3,5-dimethylcyclohexa-1,5-dien-1-yl)propanoate |
| SMILES | CCCOC(=O)CCC1=CC(C)C(O)C(C)=C1 |
| InChI | InChI=1S/C14H22O3/c1-4-7-17-13(15)6-5-12-8-10(2)14(16)11(3)9-12/h8-10,14,16H,4-7H2,1-3H3 |
| InChIKey | NOBUGUFDVVXLNB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propyl 3-(4-hydroxy-3,5-dimethylcyclohexa-1,5-dien-1-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 3-(4-hydroxy-3,5-dimethylcyclohexa-1,5-dien-1-yl)propanoate?
The IUPAC name of propyl 3-(4-hydroxy-3,5-dimethylcyclohexa-1,5-dien-1-yl)propanoate (CID 91333488) is propyl 3-(4-hydroxy-3,5-dimethylcyclohexa-1,5-dien-1-yl)propanoate.
What is the SMILES notation for propyl 3-(4-hydroxy-3,5-dimethylcyclohexa-1,5-dien-1-yl)propanoate?
The canonical SMILES for propyl 3-(4-hydroxy-3,5-dimethylcyclohexa-1,5-dien-1-yl)propanoate is CCCOC(=O)CCC1=CC(C)C(O)C(C)=C1.
What is the InChIKey of propyl 3-(4-hydroxy-3,5-dimethylcyclohexa-1,5-dien-1-yl)propanoate?
The InChIKey is NOBUGUFDVVXLNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O3/c1-4-7-17-13(15)6-5-12-8-10(2)14(16)11(3)9-12/h8-10,14,16H,4-7H2,1-3H3.
What are the key properties of propyl 3-(4-hydroxy-3,5-dimethylcyclohexa-1,5-dien-1-yl)propanoate?
propyl 3-(4-hydroxy-3,5-dimethylcyclohexa-1,5-dien-1-yl)propanoate has a molecular weight of 238.33 g/mol, XLogP of 2.60, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 3-(4-hydroxy-3,5-dimethylcyclohexa-1,5-dien-1-yl)propanoate is sourced from PubChem (CID 91333488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).