C16H22N2O2 — CID 91338905
1-[2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethyl]piperazine (PubChem CID 91338905) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-[2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethyl]piperazine.
| Compound Name | 1-[2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethyl]piperazine |
|---|---|
| PubChem CID | 91338905 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-[2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethyl]piperazine |
| SMILES | C1=CCCC(CC(C2=COC=CO2)N2CCNCC2)=C1 |
| InChI | InChI=1S/C16H22N2O2/c1-2-4-14(5-3-1)12-15(16-13-19-10-11-20-16)18-8-6-17-7-9-18/h1-2,4,10-11,13,15,17H,3,5-9,12H2 |
| InChIKey | WZUQKKDEUUAKFR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |