C18H23NO2 — CID 91315062
1-[2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethyl]-5-methyl-3,6-dihydro-2H-pyridine (PubChem CID 91315062) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-[2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethyl]-5-methyl-3,6-dihydro-2H-pyridine.
| Compound Name | 1-[2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethyl]-5-methyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 91315062 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 1-[2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethyl]-5-methyl-3,6-dihydro-2H-pyridine |
| SMILES | CC1=CCCN(C(CC2=CC=CCC2)C2=COC=CO2)C1 |
| InChI | InChI=1S/C18H23NO2/c1-15-6-5-9-19(13-15)17(18-14-20-10-11-21-18)12-16-7-3-2-4-8-16/h2-3,6-7,10-11,14,17H,4-5,8-9,12-13H2,1H3 |
| InChIKey | XICWKBGVWSRZKZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|