C21H15Cl3F6N4O3 — CID 91342513
2-[[[2-chloro-4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]phenyl]-(hydroxyamino)methylidene]amino]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 91342513) has the molecular formula C21H15Cl3F6N4O3 and a molecular weight of 591.72 g/mol. Its IUPAC name is 2-[[[2-chloro-4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]phenyl]-(hydroxyamino)methylidene]amino]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[[[2-chloro-4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]phenyl]-(hydroxyamino)methylidene]amino]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 91342513 |
| Molecular Formula | C21H15Cl3F6N4O3 |
| Molecular Weight | 591.72 g/mol |
| Exact Mass | 590.01 |
| IUPAC Name | 2-[[[2-chloro-4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]phenyl]-(hydroxyamino)methylidene]amino]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(C/N=C(\NO)c1ccc(C2=CC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)ON2)cc1Cl)NCC(F)(F)F |
| InChI | InChI=1S/C21H15Cl3F6N4O3/c22-12-4-11(5-13(23)6-12)19(21(28,29)30)7-16(34-37-19)10-1-2-14(15(24)3-10)18(33-36)31-8-17(35)32-9-20(25,26)27/h1-7,34,36H,8-9H2,(H,31,33)(H,32,35) |
| InChIKey | PFJOCAWESRYHOE-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.72 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|