C18H22N2O4S — CID 91345314
[5-[(2R)-2-(benzylamino)propyl]-2-methoxyphenyl]-oxomethanesulfonamide (PubChem CID 91345314) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is [5-[(2R)-2-(benzylamino)propyl]-2-methoxyphenyl]-oxomethanesulfonamide.
| Compound Name | [5-[(2R)-2-(benzylamino)propyl]-2-methoxyphenyl]-oxomethanesulfonamide |
|---|---|
| PubChem CID | 91345314 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | [5-[(2R)-2-(benzylamino)propyl]-2-methoxyphenyl]-oxomethanesulfonamide |
| SMILES | COc1ccc(C[C@@H](C)NCc2ccccc2)cc1C(=O)S(N)(=O)=O |
| InChI | InChI=1S/C18H22N2O4S/c1-13(20-12-14-6-4-3-5-7-14)10-15-8-9-17(24-2)16(11-15)18(21)25(19,22)23/h3-9,11,13,20H,10,12H2,1-2H3,(H2,19,22,23)/t13-/m1/s1 |
| InChIKey | YTJZXQJCXXPPGA-CYBMUJFWSA-N |
| XLogP | 1.84 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|