C23H24N2O6 — CID 91347123
N-(1,3-benzodioxol-5-yl)-7-methoxy-2-oxo-8-pentoxy-1H-quinoline-3-carboxamide (PubChem CID 91347123) has the molecular formula C23H24N2O6 and a molecular weight of 424.45 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-7-methoxy-2-oxo-8-pentoxy-1H-quinoline-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-7-methoxy-2-oxo-8-pentoxy-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 91347123 |
| Molecular Formula | C23H24N2O6 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-7-methoxy-2-oxo-8-pentoxy-1H-quinoline-3-carboxamide |
| SMILES | CCCCCOc1c(OC)ccc2cc(C(=O)Nc3ccc4c(c3)OCO4)c(=O)[nH]c12 |
| InChI | InChI=1S/C23H24N2O6/c1-3-4-5-10-29-21-18(28-2)8-6-14-11-16(23(27)25-20(14)21)22(26)24-15-7-9-17-19(12-15)31-13-30-17/h6-9,11-12H,3-5,10,13H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | GKSIACOVSCJCQB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|