C24H26N2O6 — CID 23555608
N-(1,3-benzodioxol-5-ylmethyl)-7-methoxy-2-oxo-6-pentoxy-1H-quinoline-3-carboxamide (PubChem CID 23555608) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-7-methoxy-2-oxo-6-pentoxy-1H-quinoline-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-7-methoxy-2-oxo-6-pentoxy-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 23555608 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-7-methoxy-2-oxo-6-pentoxy-1H-quinoline-3-carboxamide |
| SMILES | CCCCCOc1cc2cc(C(=O)NCc3ccc4c(c3)OCO4)c(=O)[nH]c2cc1OC |
| InChI | InChI=1S/C24H26N2O6/c1-3-4-5-8-30-22-11-16-10-17(24(28)26-18(16)12-20(22)29-2)23(27)25-13-15-6-7-19-21(9-15)32-14-31-19/h6-7,9-12H,3-5,8,13-14H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | CTVHLDFJRQAZMX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|