C8H15NO — CID 91348701
1-hydroxy-5-propan-2-yl-3,4-dihydro-2H-pyridine (PubChem CID 91348701) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is 1-hydroxy-5-propan-2-yl-3,4-dihydro-2H-pyridine.
| Compound Name | 1-hydroxy-5-propan-2-yl-3,4-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 91348701 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 1-hydroxy-5-propan-2-yl-3,4-dihydro-2H-pyridine |
| SMILES | CC(C)C1=CN(O)CCC1 |
| InChI | InChI=1S/C8H15NO/c1-7(2)8-4-3-5-9(10)6-8/h6-7,10H,3-5H2,1-2H3 |
| InChIKey | LQITWINWLCVUOK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |