C12H25N — CID 156888295
ethane;1-methyl-6-propan-2-yl-2,3,4,7-tetrahydroazepine (PubChem CID 156888295) has the molecular formula C12H25N and a molecular weight of 183.34 g/mol. Its IUPAC name is ethane;1-methyl-6-propan-2-yl-2,3,4,7-tetrahydroazepine.
| Compound Name | ethane;1-methyl-6-propan-2-yl-2,3,4,7-tetrahydroazepine |
|---|---|
| PubChem CID | 156888295 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | ethane;1-methyl-6-propan-2-yl-2,3,4,7-tetrahydroazepine |
| SMILES | CC.CC(C)C1=CCCCN(C)C1 |
| InChI | InChI=1S/C10H19N.C2H6/c1-9(2)10-6-4-5-7-11(3)8-10;1-2/h6,9H,4-5,7-8H2,1-3H3;1-2H3 |
| InChIKey | IRAXCSFTDSHWOZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|