C13H17NOS — CID 91349252
6-butyl-6-methyl-3H-cyclohepta[d][1,3]thiazol-2-one (PubChem CID 91349252) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is 6-butyl-6-methyl-3H-cyclohepta[d][1,3]thiazol-2-one.
| Compound Name | 6-butyl-6-methyl-3H-cyclohepta[d][1,3]thiazol-2-one |
|---|---|
| PubChem CID | 91349252 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 6-butyl-6-methyl-3H-cyclohepta[d][1,3]thiazol-2-one |
| SMILES | CCCCC1(C)C=Cc2[nH]c(=O)sc2C=C1 |
| InChI | InChI=1S/C13H17NOS/c1-3-4-7-13(2)8-5-10-11(6-9-13)16-12(15)14-10/h5-6,8-9H,3-4,7H2,1-2H3,(H,14,15) |
| InChIKey | BVQKBUITUIENFY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |