C13H15NOS — CID 82082872
4-(4-butylphenyl)-3H-1,3-thiazol-2-one (PubChem CID 82082872) has the molecular formula C13H15NOS and a molecular weight of 233.34 g/mol. Its IUPAC name is 4-(4-butylphenyl)-3H-1,3-thiazol-2-one.
| Compound Name | 4-(4-butylphenyl)-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 82082872 |
| Molecular Formula | C13H15NOS |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 4-(4-butylphenyl)-3H-1,3-thiazol-2-one |
| SMILES | CCCCc1ccc(-c2csc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C13H15NOS/c1-2-3-4-10-5-7-11(8-6-10)12-9-16-13(15)14-12/h5-9H,2-4H2,1H3,(H,14,15) |
| InChIKey | WXBLHPDQPWSEHZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |