C28H38F3N2O6P — CID 91351380
N-[(2R)-4-diethoxyphosphoryl-1-[4-[[4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methoxy]phenyl]but-3-en-2-yl]hexanamide (PubChem CID 91351380) has the molecular formula C28H38F3N2O6P and a molecular weight of 586.59 g/mol. Its IUPAC name is N-[(2R)-4-diethoxyphosphoryl-1-[4-[[4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methoxy]phenyl]but-3-en-2-yl]hexanamide.
| Compound Name | N-[(2R)-4-diethoxyphosphoryl-1-[4-[[4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methoxy]phenyl]but-3-en-2-yl]hexanamide |
|---|---|
| PubChem CID | 91351380 |
| Molecular Formula | C28H38F3N2O6P |
| Molecular Weight | 586.59 g/mol |
| Exact Mass | 586.24 |
| IUPAC Name | N-[(2R)-4-diethoxyphosphoryl-1-[4-[[4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methoxy]phenyl]but-3-en-2-yl]hexanamide |
| SMILES | CCCCCC(=O)N[C@@H](C=CP(=O)(OCC)OCC)Cc1ccc(OCc2cc(OCC(F)(F)F)ccn2)cc1 |
| InChI | InChI=1S/C28H38F3N2O6P/c1-4-7-8-9-27(34)33-23(15-17-40(35,38-5-2)39-6-3)18-22-10-12-25(13-11-22)36-20-24-19-26(14-16-32-24)37-21-28(29,30)31/h10-17,19,23H,4-9,18,20-21H2,1-3H3,(H,33,34)/t23-/m0/s1 |
| InChIKey | OUMUMMVBBDPENA-QHCPKHFHSA-N |
| XLogP | 6.99 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.59 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|