C25H24F3N2O6P — CID 143618785
[(E)-3-benzamido-4-[4-[[4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methoxy]phenyl]but-1-enyl]phosphonic acid (PubChem CID 143618785) has the molecular formula C25H24F3N2O6P and a molecular weight of 536.44 g/mol. Its IUPAC name is [(E)-3-benzamido-4-[4-[[4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methoxy]phenyl]but-1-enyl]phosphonic acid.
| Compound Name | [(E)-3-benzamido-4-[4-[[4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methoxy]phenyl]but-1-enyl]phosphonic acid |
|---|---|
| PubChem CID | 143618785 |
| Molecular Formula | C25H24F3N2O6P |
| Molecular Weight | 536.44 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | [(E)-3-benzamido-4-[4-[[4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methoxy]phenyl]but-1-enyl]phosphonic acid |
| SMILES | O=C(NC(/C=C/P(=O)(O)O)Cc1ccc(OCc2cc(OCC(F)(F)F)ccn2)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H24F3N2O6P/c26-25(27,28)17-36-23-10-12-29-21(15-23)16-35-22-8-6-18(7-9-22)14-20(11-13-37(32,33)34)30-24(31)19-4-2-1-3-5-19/h1-13,15,20H,14,16-17H2,(H,30,31)(H2,32,33,34)/b13-11+ |
| InChIKey | PARULSAOZPPENU-ACCUITESSA-N |
| XLogP | 4.63 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|