C27H31N2O6P — CID 89304944
[(E,3R)-3-benzamido-4-[4-[(4-ethoxy-2-pyridinyl)methoxy]phenyl]but-1-enyl]-ethoxyphosphinic acid (PubChem CID 89304944) has the molecular formula C27H31N2O6P and a molecular weight of 510.53 g/mol. Its IUPAC name is [(E,3R)-3-benzamido-4-[4-[(4-ethoxy-2-pyridinyl)methoxy]phenyl]but-1-enyl]-ethoxyphosphinic acid.
| Compound Name | [(E,3R)-3-benzamido-4-[4-[(4-ethoxy-2-pyridinyl)methoxy]phenyl]but-1-enyl]-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 89304944 |
| Molecular Formula | C27H31N2O6P |
| Molecular Weight | 510.53 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | [(E,3R)-3-benzamido-4-[4-[(4-ethoxy-2-pyridinyl)methoxy]phenyl]but-1-enyl]-ethoxyphosphinic acid |
| SMILES | CCOc1ccnc(COc2ccc(C[C@H](/C=C/P(=O)(O)OCC)NC(=O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C27H31N2O6P/c1-3-33-26-14-16-28-24(19-26)20-34-25-12-10-21(11-13-25)18-23(15-17-36(31,32)35-4-2)29-27(30)22-8-6-5-7-9-22/h5-17,19,23H,3-4,18,20H2,1-2H3,(H,29,30)(H,31,32)/b17-15+/t23-/m0/s1 |
| InChIKey | OMOLKSQBLGXDFP-GGJDQLKOSA-N |
| XLogP | 5.14 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|