C46H42F6N2O8 — CID 91352273
bis[1-amino-4-(6-methoxynaphthalen-2-yl)-3-[4-(trifluoromethyl)phenoxy]butyl] oxalate (PubChem CID 91352273) has the molecular formula C46H42F6N2O8 and a molecular weight of 864.84 g/mol. Its IUPAC name is bis[1-amino-4-(6-methoxynaphthalen-2-yl)-3-[4-(trifluoromethyl)phenoxy]butyl] oxalate.
| Compound Name | bis[1-amino-4-(6-methoxynaphthalen-2-yl)-3-[4-(trifluoromethyl)phenoxy]butyl] oxalate |
|---|---|
| PubChem CID | 91352273 |
| Molecular Formula | C46H42F6N2O8 |
| Molecular Weight | 864.84 g/mol |
| Exact Mass | 864.28 |
| IUPAC Name | bis[1-amino-4-(6-methoxynaphthalen-2-yl)-3-[4-(trifluoromethyl)phenoxy]butyl] oxalate |
| SMILES | COc1ccc2cc(CC(CC(N)OC(=O)C(=O)OC(N)CC(Cc3ccc4cc(OC)ccc4c3)Oc3ccc(C(F)(F)F)cc3)Oc3ccc(C(F)(F)F)cc3)ccc2c1 |
| InChI | InChI=1S/C46H42F6N2O8/c1-57-37-13-7-29-19-27(3-5-31(29)23-37)21-39(59-35-15-9-33(10-16-35)45(47,48)49)25-41(53)61-43(55)44(56)62-42(54)26-40(60-36-17-11-34(12-18-36)46(50,51)52)22-28-4-6-32-24-38(58-2)14-8-30(32)20-28/h3-20,23-24,39-42H,21-22,25-26,53-54H2,1-2H3 |
| InChIKey | CUVRPBSJYUZBJD-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 141.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.84 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|